C10H18F6N2O2 — CID 2767999
1,1,1-trifluoro-3-[4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butylamino]propan-2-ol (PubChem CID 2767999) has the molecular formula C10H18F6N2O2 and a molecular weight of 312.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butylamino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butylamino]propan-2-ol |
|---|---|
| PubChem CID | 2767999 |
| Molecular Formula | C10H18F6N2O2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1,1,1-trifluoro-3-[4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butylamino]propan-2-ol |
| SMILES | OC(CNCCCCNCC(O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H18F6N2O2/c11-9(12,13)7(19)5-17-3-1-2-4-18-6-8(20)10(14,15)16/h7-8,17-20H,1-6H2 |
| InChIKey | ODDKDYALYCGAFA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|