About 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine
3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine (PubChem CID 2768030) has the molecular formula C16H16N4
and a molecular weight of 264.33 g/mol. Its IUPAC name is 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine |
| PubChem CID | 2768030 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine |
| SMILES | Cc1ccccc1-c1nnc(-c2ccccc2C)n1N |
| InChI | InChI=1S/C16H16N4/c1-11-7-3-5-9-13(11)15-18-19-16(20(15)17)14-10-6-4-8-12(14)2/h3-10H,17H2,1-2H3 |
| InChIKey | YCFUPKXYQAEZDO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine (CID 2768030) is 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine is Cc1ccccc1-c1nnc(-c2ccccc2C)n1N.
What is the InChIKey of 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine?
The InChIKey is YCFUPKXYQAEZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4/c1-11-7-3-5-9-13(11)15-18-19-16(20(15)17)14-10-6-4-8-12(14)2/h3-10H,17H2,1-2H3.
What are the key properties of 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine?
3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine has a molecular weight of 264.33 g/mol, XLogP of 2.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(2-methylphenyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 2768030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).