About 1-methylindazol-5-amine
1-methylindazol-5-amine (PubChem CID 2768032) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-methylindazol-5-amine.
Molecular Properties
| Compound Name | 1-methylindazol-5-amine |
| PubChem CID | 2768032 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1-methylindazol-5-amine |
| SMILES | Cn1ncc2cc(N)ccc21 |
| InChI | InChI=1S/C8H9N3/c1-11-8-3-2-7(9)4-6(8)5-10-11/h2-5H,9H2,1H3 |
| InChIKey | PYOFNPHTKBSXOM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindazol-5-amine?
The IUPAC name of 1-methylindazol-5-amine (CID 2768032) is 1-methylindazol-5-amine.
What is the SMILES notation for 1-methylindazol-5-amine?
The canonical SMILES for 1-methylindazol-5-amine is Cn1ncc2cc(N)ccc21.
What is the InChIKey of 1-methylindazol-5-amine?
The InChIKey is PYOFNPHTKBSXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-11-8-3-2-7(9)4-6(8)5-10-11/h2-5H,9H2,1H3.
What are the key properties of 1-methylindazol-5-amine?
1-methylindazol-5-amine has a molecular weight of 147.18 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindazol-5-amine is sourced from PubChem (CID 2768032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).