C10H10N2O — CID 2768260
2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile (PubChem CID 2768260) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile.
| Compound Name | 2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 2768260 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c([nH]c1=O)CCCC2 |
| InChI | InChI=1S/C10H10N2O/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13/h5H,1-4H2,(H,12,13) |
| InChIKey | JSLZOLIKGOFOOE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |