C16H15FN2O2S — CID 27684200
N'-[2-(3-fluorophenyl)acetyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide (PubChem CID 27684200) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is N'-[2-(3-fluorophenyl)acetyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(3-fluorophenyl)acetyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 27684200 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N'-[2-(3-fluorophenyl)acetyl]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbohydrazide |
| SMILES | O=C(Cc1cccc(F)c1)NNC(=O)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C16H15FN2O2S/c17-12-5-1-3-10(7-12)8-15(20)18-19-16(21)14-9-11-4-2-6-13(11)22-14/h1,3,5,7,9H,2,4,6,8H2,(H,18,20)(H,19,21) |
| InChIKey | QRXBLLDOVRJDLS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|