About 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline
2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline (PubChem CID 2768435) has the molecular formula C18H15NO4
and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline |
| PubChem CID | 2768435 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline |
| SMILES | COc1ccc(OC)c2nc(-c3ccc4c(c3)OCO4)ccc12 |
| InChI | InChI=1S/C18H15NO4/c1-20-14-7-8-16(21-2)18-12(14)4-5-13(19-18)11-3-6-15-17(9-11)23-10-22-15/h3-9H,10H2,1-2H3 |
| InChIKey | ZXFPTHSTAZIDFT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline (CID 2768435) is 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline is COc1ccc(OC)c2nc(-c3ccc4c(c3)OCO4)ccc12.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline?
The InChIKey is ZXFPTHSTAZIDFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4/c1-20-14-7-8-16(21-2)18-12(14)4-5-13(19-18)11-3-6-15-17(9-11)23-10-22-15/h3-9H,10H2,1-2H3.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline?
2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline has a molecular weight of 309.32 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-5,8-dimethoxyquinoline is sourced from PubChem (CID 2768435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).