About 4-imidazol-1-ylbenzamide
4-imidazol-1-ylbenzamide (PubChem CID 2768493) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-imidazol-1-ylbenzamide.
Molecular Properties
| Compound Name | 4-imidazol-1-ylbenzamide |
| PubChem CID | 2768493 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4-imidazol-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C10H9N3O/c11-10(14)8-1-3-9(4-2-8)13-6-5-12-7-13/h1-7H,(H2,11,14) |
| InChIKey | VEKNMVRNEBNHNU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-imidazol-1-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-ylbenzamide?
The IUPAC name of 4-imidazol-1-ylbenzamide (CID 2768493) is 4-imidazol-1-ylbenzamide.
What is the SMILES notation for 4-imidazol-1-ylbenzamide?
The canonical SMILES for 4-imidazol-1-ylbenzamide is NC(=O)c1ccc(-n2ccnc2)cc1.
What is the InChIKey of 4-imidazol-1-ylbenzamide?
The InChIKey is VEKNMVRNEBNHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-10(14)8-1-3-9(4-2-8)13-6-5-12-7-13/h1-7H,(H2,11,14).
What are the key properties of 4-imidazol-1-ylbenzamide?
4-imidazol-1-ylbenzamide has a molecular weight of 187.20 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-ylbenzamide is sourced from PubChem (CID 2768493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).