C11H9Cl3N2OS — CID 2768665
2,2,2-trichloro-1-[1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrol-2-yl]ethanone (PubChem CID 2768665) has the molecular formula C11H9Cl3N2OS and a molecular weight of 323.63 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrol-2-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 2768665 |
| Molecular Formula | C11H9Cl3N2OS |
| Molecular Weight | 323.63 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | 2,2,2-trichloro-1-[1-methyl-4-(2-methyl-1,3-thiazol-4-yl)pyrrol-2-yl]ethanone |
| SMILES | Cc1nc(-c2cc(C(=O)C(Cl)(Cl)Cl)n(C)c2)cs1 |
| InChI | InChI=1S/C11H9Cl3N2OS/c1-6-15-8(5-18-6)7-3-9(16(2)4-7)10(17)11(12,13)14/h3-5H,1-2H3 |
| InChIKey | SOOXDIZJATUGDZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|