About 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid
5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid (PubChem CID 2768675) has the molecular formula C12H11ClN2O3
and a molecular weight of 266.68 g/mol. Its IUPAC name is 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid |
| PubChem CID | 2768675 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid |
| SMILES | Cc1nn(C)c(Oc2cccc(Cl)c2)c1C(=O)O |
| InChI | InChI=1S/C12H11ClN2O3/c1-7-10(12(16)17)11(15(2)14-7)18-9-5-3-4-8(13)6-9/h3-6H,1-2H3,(H,16,17) |
| InChIKey | GUZQYDFNVLHCFL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid?
The IUPAC name of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid (CID 2768675) is 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid.
What is the SMILES notation for 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid?
The canonical SMILES for 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid is Cc1nn(C)c(Oc2cccc(Cl)c2)c1C(=O)O.
What is the InChIKey of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid?
The InChIKey is GUZQYDFNVLHCFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O3/c1-7-10(12(16)17)11(15(2)14-7)18-9-5-3-4-8(13)6-9/h3-6H,1-2H3,(H,16,17).
What are the key properties of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid?
5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid has a molecular weight of 266.68 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid is sourced from PubChem (CID 2768675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).