About 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide
2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 2768692) has the molecular formula C13H12N2OS
and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 2768692 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H12N2OS/c1-2-8-14-12(16)11-9-17-13(15-11)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,14,16) |
| InChIKey | HPSJITMHRJUUMB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide (CID 2768692) is 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide is C=CCNC(=O)c1csc(-c2ccccc2)n1.
What is the InChIKey of 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide?
The InChIKey is HPSJITMHRJUUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2OS/c1-2-8-14-12(16)11-9-17-13(15-11)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,14,16).
What are the key properties of 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide?
2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide has a molecular weight of 244.32 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N-prop-2-enyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 2768692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).