C24H26N4O4S2 — CID 27688337
2-(4-ethylphenyl)-4-methyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 27688337) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-4-methyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-ethylphenyl)-4-methyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 27688337 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 2-(4-ethylphenyl)-4-methyl-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | CCc1ccc(-c2nc(C)c(C(=O)NNC(=O)c3ccc(S(=O)(=O)N4CCCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C24H26N4O4S2/c1-3-17-6-8-19(9-7-17)24-25-16(2)21(33-24)23(30)27-26-22(29)18-10-12-20(13-11-18)34(31,32)28-14-4-5-15-28/h6-13H,3-5,14-15H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | TWUCIOYURHUUKD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|