C22H25F3N6O2 — CID 27688708
4-tert-butyl-N'-[3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoyl]benzohydrazide (PubChem CID 27688708) has the molecular formula C22H25F3N6O2 and a molecular weight of 462.48 g/mol. Its IUPAC name is 4-tert-butyl-N'-[3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoyl]benzohydrazide.
| Compound Name | 4-tert-butyl-N'-[3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 27688708 |
| Molecular Formula | C22H25F3N6O2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-tert-butyl-N'-[3-[5,7-dimethyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanoyl]benzohydrazide |
| SMILES | Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)NNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25F3N6O2/c1-12-16(13(2)31-20(26-12)27-19(30-31)22(23,24)25)10-11-17(32)28-29-18(33)14-6-8-15(9-7-14)21(3,4)5/h6-9H,10-11H2,1-5H3,(H,28,32)(H,29,33) |
| InChIKey | XZKZUVSEKAXQIL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|