About 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one
5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one (PubChem CID 2768966) has the molecular formula C15H15N3O
and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one |
| PubChem CID | 2768966 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one |
| SMILES | Cc1cc2nc(-c3ccc(=O)[nH]c3)n(C)c2cc1C |
| InChI | InChI=1S/C15H15N3O/c1-9-6-12-13(7-10(9)2)18(3)15(17-12)11-4-5-14(19)16-8-11/h4-8H,1-3H3,(H,16,19) |
| InChIKey | ADFJDRXUKAHTAY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one?
The IUPAC name of 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one (CID 2768966) is 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one.
What is the SMILES notation for 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one?
The canonical SMILES for 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one is Cc1cc2nc(-c3ccc(=O)[nH]c3)n(C)c2cc1C.
What is the InChIKey of 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one?
The InChIKey is ADFJDRXUKAHTAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O/c1-9-6-12-13(7-10(9)2)18(3)15(17-12)11-4-5-14(19)16-8-11/h4-8H,1-3H3,(H,16,19).
What are the key properties of 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one?
5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one has a molecular weight of 253.30 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,5,6-trimethylbenzimidazol-2-yl)-1H-pyridin-2-one is sourced from PubChem (CID 2768966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).