C11H11N3OS — CID 2768975
8-methyl-2-prop-2-enylsulfanylpyrido[1,2-a][1,3,5]triazin-4-one (PubChem CID 2768975) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 8-methyl-2-prop-2-enylsulfanylpyrido[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 8-methyl-2-prop-2-enylsulfanylpyrido[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 2768975 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 8-methyl-2-prop-2-enylsulfanylpyrido[1,2-a][1,3,5]triazin-4-one |
| SMILES | C=CCSc1nc(=O)n2ccc(C)cc2n1 |
| InChI | InChI=1S/C11H11N3OS/c1-3-6-16-10-12-9-7-8(2)4-5-14(9)11(15)13-10/h3-5,7H,1,6H2,2H3 |
| InChIKey | KBYGZELVBOGYSD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|