About 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide
3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide (PubChem CID 2769021) has the molecular formula C19H14ClN3O
and a molecular weight of 335.79 g/mol. Its IUPAC name is 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide |
| PubChem CID | 2769021 |
| Molecular Formula | C19H14ClN3O |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide |
| SMILES | O=C(Nc1ncc2c(n1)-c1ccccc1CC2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H14ClN3O/c20-15-6-3-5-13(10-15)18(24)23-19-21-11-14-9-8-12-4-1-2-7-16(12)17(14)22-19/h1-7,10-11H,8-9H2,(H,21,22,23,24) |
| InChIKey | WMOGAFSFMTWERV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide?
The IUPAC name of 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide (CID 2769021) is 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide.
What is the SMILES notation for 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide?
The canonical SMILES for 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide is O=C(Nc1ncc2c(n1)-c1ccccc1CC2)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide?
The InChIKey is WMOGAFSFMTWERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3O/c20-15-6-3-5-13(10-15)18(24)23-19-21-11-14-9-8-12-4-1-2-7-16(12)17(14)22-19/h1-7,10-11H,8-9H2,(H,21,22,23,24).
What are the key properties of 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide?
3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide has a molecular weight of 335.79 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(5,6-dihydrobenzo[h]quinazolin-2-yl)benzamide is sourced from PubChem (CID 2769021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).