C10H8N2OS3 — CID 2769195
2-methyl-N-(5-sulfanylidene-1,2,4-dithiazol-3-yl)benzamide (PubChem CID 2769195) has the molecular formula C10H8N2OS3 and a molecular weight of 268.39 g/mol. Its IUPAC name is 2-methyl-N-(5-sulfanylidene-1,2,4-dithiazol-3-yl)benzamide.
| Compound Name | 2-methyl-N-(5-sulfanylidene-1,2,4-dithiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 2769195 |
| Molecular Formula | C10H8N2OS3 |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2-methyl-N-(5-sulfanylidene-1,2,4-dithiazol-3-yl)benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1nc(=S)ss1 |
| InChI | InChI=1S/C10H8N2OS3/c1-6-4-2-3-5-7(6)8(13)11-9-12-10(14)16-15-9/h2-5H,1H3,(H,11,12,13,14) |
| InChIKey | CKCZMSJXYALFOI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|