About 3,5-diheptyl-1,2,4-triazol-4-amine
3,5-diheptyl-1,2,4-triazol-4-amine (PubChem CID 2769373) has the molecular formula C16H32N4
and a molecular weight of 280.46 g/mol. Its IUPAC name is 3,5-diheptyl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-diheptyl-1,2,4-triazol-4-amine |
| PubChem CID | 2769373 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 3,5-diheptyl-1,2,4-triazol-4-amine |
| SMILES | CCCCCCCc1nnc(CCCCCCC)n1N |
| InChI | InChI=1S/C16H32N4/c1-3-5-7-9-11-13-15-18-19-16(20(15)17)14-12-10-8-6-4-2/h3-14,17H2,1-2H3 |
| InChIKey | HTAVZCVYBKYBBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diheptyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diheptyl-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-diheptyl-1,2,4-triazol-4-amine (CID 2769373) is 3,5-diheptyl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-diheptyl-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-diheptyl-1,2,4-triazol-4-amine is CCCCCCCc1nnc(CCCCCCC)n1N.
What is the InChIKey of 3,5-diheptyl-1,2,4-triazol-4-amine?
The InChIKey is HTAVZCVYBKYBBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4/c1-3-5-7-9-11-13-15-18-19-16(20(15)17)14-12-10-8-6-4-2/h3-14,17H2,1-2H3.
What are the key properties of 3,5-diheptyl-1,2,4-triazol-4-amine?
3,5-diheptyl-1,2,4-triazol-4-amine has a molecular weight of 280.46 g/mol, XLogP of 4.02, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diheptyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 2769373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).