About 2-bromo-3,4,6-trichlorophenol
2-bromo-3,4,6-trichlorophenol (PubChem CID 2769421) has the molecular formula C6H2BrCl3O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-bromo-3,4,6-trichlorophenol.
Molecular Properties
| Compound Name | 2-bromo-3,4,6-trichlorophenol |
| PubChem CID | 2769421 |
| Molecular Formula | C6H2BrCl3O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 273.84 |
| IUPAC Name | 2-bromo-3,4,6-trichlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)c(Cl)c1Br |
| InChI | InChI=1S/C6H2BrCl3O/c7-4-5(10)2(8)1-3(9)6(4)11/h1,11H |
| InChIKey | IFXJBIXHNZHYGK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3,4,6-trichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,4,6-trichlorophenol?
The IUPAC name of 2-bromo-3,4,6-trichlorophenol (CID 2769421) is 2-bromo-3,4,6-trichlorophenol.
What is the SMILES notation for 2-bromo-3,4,6-trichlorophenol?
The canonical SMILES for 2-bromo-3,4,6-trichlorophenol is Oc1c(Cl)cc(Cl)c(Cl)c1Br.
What is the InChIKey of 2-bromo-3,4,6-trichlorophenol?
The InChIKey is IFXJBIXHNZHYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrCl3O/c7-4-5(10)2(8)1-3(9)6(4)11/h1,11H.
What are the key properties of 2-bromo-3,4,6-trichlorophenol?
2-bromo-3,4,6-trichlorophenol has a molecular weight of 276.34 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4,6-trichlorophenol is sourced from PubChem (CID 2769421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).