C30H24N6 — CID 2769422
1-[2,3,4,5,6-penta(pyrrol-1-yl)phenyl]pyrrole (PubChem CID 2769422) has the molecular formula C30H24N6 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-[2,3,4,5,6-penta(pyrrol-1-yl)phenyl]pyrrole.
| Compound Name | 1-[2,3,4,5,6-penta(pyrrol-1-yl)phenyl]pyrrole |
|---|---|
| PubChem CID | 2769422 |
| Molecular Formula | C30H24N6 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 1-[2,3,4,5,6-penta(pyrrol-1-yl)phenyl]pyrrole |
| SMILES | c1ccn(-c2c(-n3cccc3)c(-n3cccc3)c(-n3cccc3)c(-n3cccc3)c2-n2cccc2)c1 |
| InChI | InChI=1S/C30H24N6/c1-2-14-31(13-1)25-26(32-15-3-4-16-32)28(34-19-7-8-20-34)30(36-23-11-12-24-36)29(35-21-9-10-22-35)27(25)33-17-5-6-18-33/h1-24H |
| InChIKey | LLQRRQZTMPJPMZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 29.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |