About 1-methylindol-5-amine
1-methylindol-5-amine (PubChem CID 2769564) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-methylindol-5-amine.
Molecular Properties
| Compound Name | 1-methylindol-5-amine |
| PubChem CID | 2769564 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1-methylindol-5-amine |
| SMILES | Cn1ccc2cc(N)ccc21 |
| InChI | InChI=1S/C9H10N2/c1-11-5-4-7-6-8(10)2-3-9(7)11/h2-6H,10H2,1H3 |
| InChIKey | PGTSGPCXPIFQEL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk_indol_A(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-methylindol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylindol-5-amine?
The IUPAC name of 1-methylindol-5-amine (CID 2769564) is 1-methylindol-5-amine.
What is the SMILES notation for 1-methylindol-5-amine?
The canonical SMILES for 1-methylindol-5-amine is Cn1ccc2cc(N)ccc21.
What is the InChIKey of 1-methylindol-5-amine?
The InChIKey is PGTSGPCXPIFQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-11-5-4-7-6-8(10)2-3-9(7)11/h2-6H,10H2,1H3.
What are the key properties of 1-methylindol-5-amine?
1-methylindol-5-amine has a molecular weight of 146.19 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylindol-5-amine is sourced from PubChem (CID 2769564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).