C9H7BrN2O2 — CID 2769569
7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 2769569) has the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. Its IUPAC name is 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 2769569 |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1CNC(=O)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C9H7BrN2O2/c10-5-1-2-7-6(3-5)9(14)11-4-8(13)12-7/h1-3H,4H2,(H,11,14)(H,12,13) |
| InChIKey | QTLHJODGGBYWLC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |