C8H9F9O — CID 2769649
6,6,6-trifluoro-5,5-bis(trifluoromethyl)hexan-1-ol (PubChem CID 2769649) has the molecular formula C8H9F9O and a molecular weight of 292.14 g/mol. Its IUPAC name is 6,6,6-trifluoro-5,5-bis(trifluoromethyl)hexan-1-ol.
| Compound Name | 6,6,6-trifluoro-5,5-bis(trifluoromethyl)hexan-1-ol |
|---|---|
| PubChem CID | 2769649 |
| Molecular Formula | C8H9F9O |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 6,6,6-trifluoro-5,5-bis(trifluoromethyl)hexan-1-ol |
| SMILES | OCCCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9O/c9-6(10,11)5(7(12,13)14,8(15,16)17)3-1-2-4-18/h18H,1-4H2 |
| InChIKey | PNDPCEQFBCCOPU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|