C18H10F14O2Si — CID 2769653
diethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane (PubChem CID 2769653) has the molecular formula C18H10F14O2Si and a molecular weight of 552.33 g/mol. Its IUPAC name is diethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane.
| Compound Name | diethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 2769653 |
| Molecular Formula | C18H10F14O2Si |
| Molecular Weight | 552.33 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | diethoxy-bis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| SMILES | CCO[Si](OCC)(c1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C18H10F14O2Si/c1-3-33-35(34-4-2,15-11(23)7(19)5(17(27,28)29)8(20)12(15)24)16-13(25)9(21)6(18(30,31)32)10(22)14(16)26/h3-4H2,1-2H3 |
| InChIKey | OWTBYQCFUUXZMA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.33 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|