C14H6F10O2Si — CID 2769655
dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 2769655) has the molecular formula C14H6F10O2Si and a molecular weight of 424.27 g/mol. Its IUPAC name is dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 2769655 |
| Molecular Formula | C14H6F10O2Si |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CO[Si](OC)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H6F10O2Si/c1-25-27(26-2,13-9(21)5(17)3(15)6(18)10(13)22)14-11(23)7(19)4(16)8(20)12(14)24/h1-2H3 |
| InChIKey | OHLKTJUGGBHLLU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|