C7H9F7O — CID 2769657
5,5,6,6,7,7,7-heptafluoroheptan-1-ol (PubChem CID 2769657) has the molecular formula C7H9F7O and a molecular weight of 242.13 g/mol. Its IUPAC name is 5,5,6,6,7,7,7-heptafluoroheptan-1-ol.
| Compound Name | 5,5,6,6,7,7,7-heptafluoroheptan-1-ol |
|---|---|
| PubChem CID | 2769657 |
| Molecular Formula | C7H9F7O |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5,5,6,6,7,7,7-heptafluoroheptan-1-ol |
| SMILES | OCCCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F7O/c8-5(9,3-1-2-4-15)6(10,11)7(12,13)14/h15H,1-4H2 |
| InChIKey | ZATDVKHJLFLLDD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|