C5H3F9O2 — CID 2769666
2,2,3,3,4,4,5,5,5-nonafluoropentanal;hydrate (PubChem CID 2769666) has the molecular formula C5H3F9O2 and a molecular weight of 266.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoropentanal;hydrate.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoropentanal;hydrate |
|---|---|
| PubChem CID | 2769666 |
| Molecular Formula | C5H3F9O2 |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoropentanal;hydrate |
| SMILES | O.O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5HF9O.H2O/c6-2(7,1-15)3(8,9)4(10,11)5(12,13)14;/h1H;1H2 |
| InChIKey | UZESRIBVQIPIHZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|