1,2,2-trifluoroethenesulfonyl fluoride

C2F4O2S — CID 2769671

IUPAC1,2,2-trifluoroethenesulfonyl fluoride
SMILESO=S(=O)(F)C(F)=C(F)F
InChIInChI=1S/C2F4O2S/c3-1(4)2(5)9(6,7)8
InChIKeyQARLOMBMXGVKNV-UHFFFAOYSA-N
MW164.08 g/mol
LogP1.32
Rot. Bonds1

About 1,2,2-trifluoroethenesulfonyl fluoride

1,2,2-trifluoroethenesulfonyl fluoride (PubChem CID 2769671) has the molecular formula C2F4O2S and a molecular weight of 164.08 g/mol. Its IUPAC name is 1,2,2-trifluoroethenesulfonyl fluoride.

Molecular Properties

Compound Name1,2,2-trifluoroethenesulfonyl fluoride
PubChem CID2769671
Molecular FormulaC2F4O2S
Molecular Weight164.08 g/mol
Exact Mass163.96
IUPAC Name1,2,2-trifluoroethenesulfonyl fluoride
SMILESO=S(=O)(F)C(F)=C(F)F
InChIInChI=1S/C2F4O2S/c3-1(4)2(5)9(6,7)8
InChIKeyQARLOMBMXGVKNV-UHFFFAOYSA-N
XLogP1.32
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.08
LogP ≤ 51.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1,2,2-trifluoroethenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,2-trifluoroethenesulfonyl fluoride?
The IUPAC name of 1,2,2-trifluoroethenesulfonyl fluoride (CID 2769671) is 1,2,2-trifluoroethenesulfonyl fluoride.
What is the SMILES notation for 1,2,2-trifluoroethenesulfonyl fluoride?
The canonical SMILES for 1,2,2-trifluoroethenesulfonyl fluoride is O=S(=O)(F)C(F)=C(F)F.
What is the InChIKey of 1,2,2-trifluoroethenesulfonyl fluoride?
The InChIKey is QARLOMBMXGVKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F4O2S/c3-1(4)2(5)9(6,7)8.
What are the key properties of 1,2,2-trifluoroethenesulfonyl fluoride?
1,2,2-trifluoroethenesulfonyl fluoride has a molecular weight of 164.08 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2-trifluoroethenesulfonyl fluoride is sourced from PubChem (CID 2769671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).