About piperazine-1-carboxamide;hydrochloride
piperazine-1-carboxamide;hydrochloride (PubChem CID 2769700) has the molecular formula C5H12ClN3O
and a molecular weight of 165.62 g/mol. Its IUPAC name is piperazine-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | piperazine-1-carboxamide;hydrochloride |
| PubChem CID | 2769700 |
| Molecular Formula | C5H12ClN3O |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | piperazine-1-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)N1CCNCC1 |
| InChI | InChI=1S/C5H11N3O.ClH/c6-5(9)8-3-1-7-2-4-8;/h7H,1-4H2,(H2,6,9);1H |
| InChIKey | UVYKKFKLOUEFAR-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperazine-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1-carboxamide;hydrochloride?
The IUPAC name of piperazine-1-carboxamide;hydrochloride (CID 2769700) is piperazine-1-carboxamide;hydrochloride.
What is the SMILES notation for piperazine-1-carboxamide;hydrochloride?
The canonical SMILES for piperazine-1-carboxamide;hydrochloride is Cl.NC(=O)N1CCNCC1.
What is the InChIKey of piperazine-1-carboxamide;hydrochloride?
The InChIKey is UVYKKFKLOUEFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.ClH/c6-5(9)8-3-1-7-2-4-8;/h7H,1-4H2,(H2,6,9);1H.
What are the key properties of piperazine-1-carboxamide;hydrochloride?
piperazine-1-carboxamide;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of -0.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1-carboxamide;hydrochloride is sourced from PubChem (CID 2769700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).