About 1-(1-adamantyl)ethanol
1-(1-adamantyl)ethanol (PubChem CID 2769713) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-(1-adamantyl)ethanol.
Molecular Properties
| Compound Name | 1-(1-adamantyl)ethanol |
| PubChem CID | 2769713 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-(1-adamantyl)ethanol |
| SMILES | CC(O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H20O/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h8-11,13H,2-7H2,1H3 |
| InChIKey | YALBLVPSPRKDJI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1-adamantyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-adamantyl)ethanol?
The IUPAC name of 1-(1-adamantyl)ethanol (CID 2769713) is 1-(1-adamantyl)ethanol.
What is the SMILES notation for 1-(1-adamantyl)ethanol?
The canonical SMILES for 1-(1-adamantyl)ethanol is CC(O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-(1-adamantyl)ethanol?
The InChIKey is YALBLVPSPRKDJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h8-11,13H,2-7H2,1H3.
What are the key properties of 1-(1-adamantyl)ethanol?
1-(1-adamantyl)ethanol has a molecular weight of 180.29 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-adamantyl)ethanol is sourced from PubChem (CID 2769713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).