C15H23NO2 — CID 2769742
1-phenylmethoxy-3-piperidin-1-ylpropan-2-ol (PubChem CID 2769742) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-phenylmethoxy-3-piperidin-1-ylpropan-2-ol.
| Compound Name | 1-phenylmethoxy-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 2769742 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-phenylmethoxy-3-piperidin-1-ylpropan-2-ol |
| SMILES | OC(COCc1ccccc1)CN1CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c17-15(11-16-9-5-2-6-10-16)13-18-12-14-7-3-1-4-8-14/h1,3-4,7-8,15,17H,2,5-6,9-13H2 |
| InChIKey | YBFNYOQFUPPMCK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |