C18H17N3O5 — CID 27698502
N'-[2-(4-cyano-2-ethoxyphenoxy)acetyl]-2-hydroxybenzohydrazide (PubChem CID 27698502) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is N'-[2-(4-cyano-2-ethoxyphenoxy)acetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-(4-cyano-2-ethoxyphenoxy)acetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 27698502 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N'-[2-(4-cyano-2-ethoxyphenoxy)acetyl]-2-hydroxybenzohydrazide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C18H17N3O5/c1-2-25-16-9-12(10-19)7-8-15(16)26-11-17(23)20-21-18(24)13-5-3-4-6-14(13)22/h3-9,22H,2,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | DGRPLMRBFKZHMK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|