About 2,3-dihydro-1,4-benzodioxine-6-sulfonamide
2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 2769942) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| PubChem CID | 2769942 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H9NO4S/c9-14(10,11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5H,3-4H2,(H2,9,10,11) |
| InChIKey | OAMPULWQGDEOHG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1,4-benzodioxine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The IUPAC name of 2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CID 2769942) is 2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxine-6-sulfonamide is NS(=O)(=O)c1ccc2c(c1)OCCO2.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The InChIKey is OAMPULWQGDEOHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c9-14(10,11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5H,3-4H2,(H2,9,10,11).
What are the key properties of 2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
2,3-dihydro-1,4-benzodioxine-6-sulfonamide has a molecular weight of 215.23 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxine-6-sulfonamide is sourced from PubChem (CID 2769942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).