C15H15NO — CID 27700
(9R,10S)-10-aminotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol (PubChem CID 27700) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (9R,10S)-10-aminotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol.
| Compound Name | (9R,10S)-10-aminotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol |
|---|---|
| PubChem CID | 27700 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (9R,10S)-10-aminotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol |
| SMILES | N[C@H]1c2ccccc2Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C15H15NO/c16-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15(14)17/h1-8,14-15,17H,9,16H2/t14-,15+/m0/s1 |
| InChIKey | LHXJSFVOWHJWNC-LSDHHAIUSA-N |
| XLogP | 2.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |