About 2,2,2-trichloro-N'-phenylethanimidamide
2,2,2-trichloro-N'-phenylethanimidamide (PubChem CID 2770203) has the molecular formula C8H7Cl3N2
and a molecular weight of 237.52 g/mol. Its IUPAC name is 2,2,2-trichloro-N'-phenylethanimidamide.
Molecular Properties
| Compound Name | 2,2,2-trichloro-N'-phenylethanimidamide |
| PubChem CID | 2770203 |
| Molecular Formula | C8H7Cl3N2 |
| Molecular Weight | 237.52 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2,2,2-trichloro-N'-phenylethanimidamide |
| SMILES | N/C(=N\c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H7Cl3N2/c9-8(10,11)7(12)13-6-4-2-1-3-5-6/h1-5H,(H2,12,13) |
| InChIKey | AURTYWGRGQGSGD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloro-N'-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloro-N'-phenylethanimidamide?
The IUPAC name of 2,2,2-trichloro-N'-phenylethanimidamide (CID 2770203) is 2,2,2-trichloro-N'-phenylethanimidamide.
What is the SMILES notation for 2,2,2-trichloro-N'-phenylethanimidamide?
The canonical SMILES for 2,2,2-trichloro-N'-phenylethanimidamide is N/C(=N\c1ccccc1)C(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloro-N'-phenylethanimidamide?
The InChIKey is AURTYWGRGQGSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl3N2/c9-8(10,11)7(12)13-6-4-2-1-3-5-6/h1-5H,(H2,12,13).
What are the key properties of 2,2,2-trichloro-N'-phenylethanimidamide?
2,2,2-trichloro-N'-phenylethanimidamide has a molecular weight of 237.52 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloro-N'-phenylethanimidamide is sourced from PubChem (CID 2770203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).