About 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide
3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide (PubChem CID 27702119) has the molecular formula C20H17N3OS
and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide |
| PubChem CID | 27702119 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide |
| SMILES | O=C(CCn1ccc2ccccc21)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C20H17N3OS/c24-19(10-13-23-12-9-15-3-1-2-4-18(15)23)22-17-7-5-16(6-8-17)20-21-11-14-25-20/h1-9,11-12,14H,10,13H2,(H,22,24) |
| InChIKey | KBBSMGXLXTXARC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide?
The IUPAC name of 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide (CID 27702119) is 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide.
What is the SMILES notation for 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide?
The canonical SMILES for 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide is O=C(CCn1ccc2ccccc21)Nc1ccc(-c2nccs2)cc1.
What is the InChIKey of 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide?
The InChIKey is KBBSMGXLXTXARC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3OS/c24-19(10-13-23-12-9-15-3-1-2-4-18(15)23)22-17-7-5-16(6-8-17)20-21-11-14-25-20/h1-9,11-12,14H,10,13H2,(H,22,24).
What are the key properties of 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide?
3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide has a molecular weight of 347.44 g/mol, XLogP of 4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-indol-1-yl-N-[4-(1,3-thiazol-2-yl)phenyl]propanamide is sourced from PubChem (CID 27702119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).