C14H22ClNO4 — CID 2770236
1-(3-methoxyphenoxy)-3-morpholin-4-ylpropan-2-ol;hydrochloride (PubChem CID 2770236) has the molecular formula C14H22ClNO4 and a molecular weight of 303.79 g/mol. Its IUPAC name is 1-(3-methoxyphenoxy)-3-morpholin-4-ylpropan-2-ol;hydrochloride.
| Compound Name | 1-(3-methoxyphenoxy)-3-morpholin-4-ylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 2770236 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(3-methoxyphenoxy)-3-morpholin-4-ylpropan-2-ol;hydrochloride |
| SMILES | COc1cccc(OCC(O)CN2CCOCC2)c1.Cl |
| InChI | InChI=1S/C14H21NO4.ClH/c1-17-13-3-2-4-14(9-13)19-11-12(16)10-15-5-7-18-8-6-15;/h2-4,9,12,16H,5-8,10-11H2,1H3;1H |
| InChIKey | QMZAJJDXVXKKKP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |