About 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid
6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid (PubChem CID 2770465) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid.
Molecular Properties
| Compound Name | 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid |
| PubChem CID | 2770465 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid |
| SMILES | CC12COC3(C(=O)O)CC1CCC32C |
| InChI | InChI=1S/C11H16O3/c1-9-6-14-11(8(12)13)5-7(9)3-4-10(9,11)2/h7H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | RTPVZSXBXIHRFM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid?
The IUPAC name of 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid (CID 2770465) is 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid.
What is the SMILES notation for 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid?
The canonical SMILES for 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid is CC12COC3(C(=O)O)CC1CCC32C.
What is the InChIKey of 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid?
The InChIKey is RTPVZSXBXIHRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-9-6-14-11(8(12)13)5-7(9)3-4-10(9,11)2/h7H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid?
6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid has a molecular weight of 196.25 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxylic acid is sourced from PubChem (CID 2770465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).