About 3-methyl-1,3-thiazolidin-2-imine;hydroiodide
3-methyl-1,3-thiazolidin-2-imine;hydroiodide (PubChem CID 2770507) has the molecular formula C4H9IN2S
and a molecular weight of 244.10 g/mol. Its IUPAC name is 3-methyl-1,3-thiazolidin-2-imine;hydroiodide.
Molecular Properties
| Compound Name | 3-methyl-1,3-thiazolidin-2-imine;hydroiodide |
| PubChem CID | 2770507 |
| Molecular Formula | C4H9IN2S |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 3-methyl-1,3-thiazolidin-2-imine;hydroiodide |
| SMILES | I.[H]/N=C1\SCCN1C |
| InChI | InChI=1S/C4H8N2S.HI/c1-6-2-3-7-4(6)5;/h5H,2-3H2,1H3;1H/b5-4-; |
| InChIKey | YBQSXVIUCDNVNV-MKWAYWHRSA-N |
| XLogP | 1.22 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,3-thiazolidin-2-imine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3-thiazolidin-2-imine;hydroiodide?
The IUPAC name of 3-methyl-1,3-thiazolidin-2-imine;hydroiodide (CID 2770507) is 3-methyl-1,3-thiazolidin-2-imine;hydroiodide.
What is the SMILES notation for 3-methyl-1,3-thiazolidin-2-imine;hydroiodide?
The canonical SMILES for 3-methyl-1,3-thiazolidin-2-imine;hydroiodide is I.[H]/N=C1\SCCN1C.
What is the InChIKey of 3-methyl-1,3-thiazolidin-2-imine;hydroiodide?
The InChIKey is YBQSXVIUCDNVNV-MKWAYWHRSA-N. The full InChI is InChI=1S/C4H8N2S.HI/c1-6-2-3-7-4(6)5;/h5H,2-3H2,1H3;1H/b5-4-;.
What are the key properties of 3-methyl-1,3-thiazolidin-2-imine;hydroiodide?
3-methyl-1,3-thiazolidin-2-imine;hydroiodide has a molecular weight of 244.10 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3-thiazolidin-2-imine;hydroiodide is sourced from PubChem (CID 2770507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).