About ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate
ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate (PubChem CID 27705808) has the molecular formula C18H17NO7
and a molecular weight of 359.33 g/mol. Its IUPAC name is ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate |
| PubChem CID | 27705808 |
| Molecular Formula | C18H17NO7 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccoc1COC(=O)CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C18H17NO7/c1-2-23-17(21)12-8-10-24-15(12)11-25-16(20)7-9-19-13-5-3-4-6-14(13)26-18(19)22/h3-6,8,10H,2,7,9,11H2,1H3 |
| InChIKey | UIRYGSFDCLWQOD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate?
The IUPAC name of ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate (CID 27705808) is ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate.
What is the SMILES notation for ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate?
The canonical SMILES for ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate is CCOC(=O)c1ccoc1COC(=O)CCn1c(=O)oc2ccccc21.
What is the InChIKey of ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate?
The InChIKey is UIRYGSFDCLWQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO7/c1-2-23-17(21)12-8-10-24-15(12)11-25-16(20)7-9-19-13-5-3-4-6-14(13)26-18(19)22/h3-6,8,10H,2,7,9,11H2,1H3.
What are the key properties of ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate?
ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate has a molecular weight of 359.33 g/mol, XLogP of 2.50, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(2-oxo-1,3-benzoxazol-3-yl)propanoyloxymethyl]furan-3-carboxylate is sourced from PubChem (CID 27705808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).