About ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride
ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride (PubChem CID 2770585) has the molecular formula C17H26Cl2N2O4
and a molecular weight of 393.31 g/mol. Its IUPAC name is ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride |
| PubChem CID | 2770585 |
| Molecular Formula | C17H26Cl2N2O4 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)N1CCN(CC(O)COCc2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C17H25ClN2O4.ClH/c1-2-24-17(22)20-9-7-19(8-10-20)11-16(21)13-23-12-14-3-5-15(18)6-4-14;/h3-6,16,21H,2,7-13H2,1H3;1H |
| InChIKey | DMLZAMSAHFMKBM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
The IUPAC name of ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride (CID 2770585) is ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
The canonical SMILES for ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride is CCOC(=O)N1CCN(CC(O)COCc2ccc(Cl)cc2)CC1.Cl.
What is the InChIKey of ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
The InChIKey is DMLZAMSAHFMKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN2O4.ClH/c1-2-24-17(22)20-9-7-19(8-10-20)11-16(21)13-23-12-14-3-5-15(18)6-4-14;/h3-6,16,21H,2,7-13H2,1H3;1H.
What are the key properties of ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride?
ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride has a molecular weight of 393.31 g/mol, XLogP of 2.41, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperazine-1-carboxylate;hydrochloride is sourced from PubChem (CID 2770585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).