About 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid
2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid (PubChem CID 2770836) has the molecular formula C5H5NO4S
and a molecular weight of 175.16 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid |
| PubChem CID | 2770836 |
| Molecular Formula | C5H5NO4S |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)CSC1=O |
| InChI | InChI=1S/C5H5NO4S/c7-3-2-11-5(10)6(3)1-4(8)9/h1-2H2,(H,8,9) |
| InChIKey | WHBNKGILKCASDH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid?
The IUPAC name of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid (CID 2770836) is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid is O=C(O)CN1C(=O)CSC1=O.
What is the InChIKey of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid?
The InChIKey is WHBNKGILKCASDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO4S/c7-3-2-11-5(10)6(3)1-4(8)9/h1-2H2,(H,8,9).
What are the key properties of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid?
2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid has a molecular weight of 175.16 g/mol, XLogP of -0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid is sourced from PubChem (CID 2770836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).