About 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide
2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide (PubChem CID 2770837) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 2770837 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide |
| SMILES | NC(=O)CC1SC(=O)N=C1N |
| InChI | InChI=1S/C5H7N3O2S/c6-3(9)1-2-4(7)8-5(10)11-2/h2H,1H2,(H2,6,9)(H2,7,8,10) |
| InChIKey | LUZDKUSVQYYXAL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide?
The IUPAC name of 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide (CID 2770837) is 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide is NC(=O)CC1SC(=O)N=C1N.
What is the InChIKey of 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide?
The InChIKey is LUZDKUSVQYYXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c6-3(9)1-2-4(7)8-5(10)11-2/h2H,1H2,(H2,6,9)(H2,7,8,10).
What are the key properties of 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide?
2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide has a molecular weight of 173.20 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-2-oxo-5H-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 2770837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).