C18H17N3O4 — CID 27708565
2-(2-nitrophenyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 27708565) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 27708565 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H17N3O4/c22-17(12-13-4-1-2-5-16(13)21(24)25)19-14-7-9-15(10-8-14)20-11-3-6-18(20)23/h1-2,4-5,7-10H,3,6,11-12H2,(H,19,22) |
| InChIKey | PKHFFHGPNKVAFR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|