C18H13ClF4N2O3 — CID 27708621
(4R,5S,6S)-6-(2-chloro-6-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one (PubChem CID 27708621) has the molecular formula C18H13ClF4N2O3 and a molecular weight of 416.76 g/mol. Its IUPAC name is (4R,5S,6S)-6-(2-chloro-6-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5S,6S)-6-(2-chloro-6-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 27708621 |
| Molecular Formula | C18H13ClF4N2O3 |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (4R,5S,6S)-6-(2-chloro-6-fluorophenyl)-4-hydroxy-4-phenyl-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@H](c2c(F)cccc2Cl)[C@H](C(=O)C(F)(F)F)[C@@](O)(c2ccccc2)N1 |
| InChI | InChI=1S/C18H13ClF4N2O3/c19-10-7-4-8-11(20)12(10)14-13(15(26)18(21,22)23)17(28,25-16(27)24-14)9-5-2-1-3-6-9/h1-8,13-14,28H,(H2,24,25,27)/t13-,14-,17+/m1/s1 |
| InChIKey | GLDVABPFDZZKSU-CPUCHLNUSA-N |
| XLogP | 3.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |