About 1H-pyrazol-5-ylthiourea
1H-pyrazol-5-ylthiourea (PubChem CID 2771004) has the molecular formula C4H6N4S
and a molecular weight of 142.19 g/mol. Its IUPAC name is 1H-pyrazol-5-ylthiourea.
Molecular Properties
| Compound Name | 1H-pyrazol-5-ylthiourea |
| PubChem CID | 2771004 |
| Molecular Formula | C4H6N4S |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 1H-pyrazol-5-ylthiourea |
| SMILES | NC(=S)Nc1ccn[nH]1 |
| InChI | InChI=1S/C4H6N4S/c5-4(9)7-3-1-2-6-8-3/h1-2H,(H4,5,6,7,8,9) |
| InChIKey | WNAOBNBWVHDICC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazol-5-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-5-ylthiourea?
The IUPAC name of 1H-pyrazol-5-ylthiourea (CID 2771004) is 1H-pyrazol-5-ylthiourea.
What is the SMILES notation for 1H-pyrazol-5-ylthiourea?
The canonical SMILES for 1H-pyrazol-5-ylthiourea is NC(=S)Nc1ccn[nH]1.
What is the InChIKey of 1H-pyrazol-5-ylthiourea?
The InChIKey is WNAOBNBWVHDICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4S/c5-4(9)7-3-1-2-6-8-3/h1-2H,(H4,5,6,7,8,9).
What are the key properties of 1H-pyrazol-5-ylthiourea?
1H-pyrazol-5-ylthiourea has a molecular weight of 142.19 g/mol, XLogP of 0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-5-ylthiourea is sourced from PubChem (CID 2771004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).