About 1,3-thiazol-2-ylthiourea
1,3-thiazol-2-ylthiourea (PubChem CID 2771008) has the molecular formula C4H5N3S2
and a molecular weight of 159.24 g/mol. Its IUPAC name is 1,3-thiazol-2-ylthiourea.
Molecular Properties
| Compound Name | 1,3-thiazol-2-ylthiourea |
| PubChem CID | 2771008 |
| Molecular Formula | C4H5N3S2 |
| Molecular Weight | 159.24 g/mol |
| Exact Mass | 158.99 |
| IUPAC Name | 1,3-thiazol-2-ylthiourea |
| SMILES | NC(=S)Nc1nccs1 |
| InChI | InChI=1S/C4H5N3S2/c5-3(8)7-4-6-1-2-9-4/h1-2H,(H3,5,6,7,8) |
| InChIKey | LOCOYCNSPKQNRY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-thiazol-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-2-ylthiourea?
The IUPAC name of 1,3-thiazol-2-ylthiourea (CID 2771008) is 1,3-thiazol-2-ylthiourea.
What is the SMILES notation for 1,3-thiazol-2-ylthiourea?
The canonical SMILES for 1,3-thiazol-2-ylthiourea is NC(=S)Nc1nccs1.
What is the InChIKey of 1,3-thiazol-2-ylthiourea?
The InChIKey is LOCOYCNSPKQNRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3S2/c5-3(8)7-4-6-1-2-9-4/h1-2H,(H3,5,6,7,8).
What are the key properties of 1,3-thiazol-2-ylthiourea?
1,3-thiazol-2-ylthiourea has a molecular weight of 159.24 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-2-ylthiourea is sourced from PubChem (CID 2771008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).