About 2-(4-methylphenyl)-1,3-thiazolidine
2-(4-methylphenyl)-1,3-thiazolidine (PubChem CID 2771069) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,3-thiazolidine |
| PubChem CID | 2771069 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-(4-methylphenyl)-1,3-thiazolidine |
| SMILES | Cc1ccc(C2NCCS2)cc1 |
| InChI | InChI=1S/C10H13NS/c1-8-2-4-9(5-3-8)10-11-6-7-12-10/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | NLKGQUAQKCOAHV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylphenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,3-thiazolidine?
The IUPAC name of 2-(4-methylphenyl)-1,3-thiazolidine (CID 2771069) is 2-(4-methylphenyl)-1,3-thiazolidine.
What is the SMILES notation for 2-(4-methylphenyl)-1,3-thiazolidine?
The canonical SMILES for 2-(4-methylphenyl)-1,3-thiazolidine is Cc1ccc(C2NCCS2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-1,3-thiazolidine?
The InChIKey is NLKGQUAQKCOAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-8-2-4-9(5-3-8)10-11-6-7-12-10/h2-5,10-11H,6-7H2,1H3.
What are the key properties of 2-(4-methylphenyl)-1,3-thiazolidine?
2-(4-methylphenyl)-1,3-thiazolidine has a molecular weight of 179.29 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,3-thiazolidine is sourced from PubChem (CID 2771069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).