About spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride
spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (PubChem CID 2771097) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride.
Molecular Properties
| Compound Name | spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| PubChem CID | 2771097 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| SMILES | Cl.O=C1CC2(CCNCC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H15NO2.ClH/c15-11-9-13(5-7-14-8-6-13)16-12-4-2-1-3-10(11)12;/h1-4,14H,5-9H2;1H |
| InChIKey | XJGPFFRUWRFXEL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
The IUPAC name of spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (CID 2771097) is spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride.
What is the SMILES notation for spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
The canonical SMILES for spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride is Cl.O=C1CC2(CCNCC2)Oc2ccccc21.
What is the InChIKey of spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
The InChIKey is XJGPFFRUWRFXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2.ClH/c15-11-9-13(5-7-14-8-6-13)16-12-4-2-1-3-10(11)12;/h1-4,14H,5-9H2;1H.
What are the key properties of spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride has a molecular weight of 253.73 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride is sourced from PubChem (CID 2771097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).