About 4-(1-adamantyl)aniline;hydrochloride
4-(1-adamantyl)aniline;hydrochloride (PubChem CID 2771137) has the molecular formula C16H22ClN
and a molecular weight of 263.81 g/mol. Its IUPAC name is 4-(1-adamantyl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-(1-adamantyl)aniline;hydrochloride |
| PubChem CID | 2771137 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-(1-adamantyl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C16H21N.ClH/c17-15-3-1-14(2-4-15)16-8-11-5-12(9-16)7-13(6-11)10-16;/h1-4,11-13H,5-10,17H2;1H |
| InChIKey | NRAKTESVTUZFBK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)aniline;hydrochloride?
The IUPAC name of 4-(1-adamantyl)aniline;hydrochloride (CID 2771137) is 4-(1-adamantyl)aniline;hydrochloride.
What is the SMILES notation for 4-(1-adamantyl)aniline;hydrochloride?
The canonical SMILES for 4-(1-adamantyl)aniline;hydrochloride is Cl.Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of 4-(1-adamantyl)aniline;hydrochloride?
The InChIKey is NRAKTESVTUZFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N.ClH/c17-15-3-1-14(2-4-15)16-8-11-5-12(9-16)7-13(6-11)10-16;/h1-4,11-13H,5-10,17H2;1H.
What are the key properties of 4-(1-adamantyl)aniline;hydrochloride?
4-(1-adamantyl)aniline;hydrochloride has a molecular weight of 263.81 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)aniline;hydrochloride is sourced from PubChem (CID 2771137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).