About 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone
2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 27716) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone |
| PubChem CID | 27716 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CNC1CCCCC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H19NO3/c16-12-7-6-10(8-13(12)17)14(18)9-15-11-4-2-1-3-5-11/h6-8,11,15-17H,1-5,9H2 |
| InChIKey | ITQFZQPBSLIEMU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone?
The IUPAC name of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone (CID 27716) is 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone.
What is the SMILES notation for 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone?
The canonical SMILES for 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone is O=C(CNC1CCCCC1)c1ccc(O)c(O)c1.
What is the InChIKey of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone?
The InChIKey is ITQFZQPBSLIEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c16-12-7-6-10(8-13(12)17)14(18)9-15-11-4-2-1-3-5-11/h6-8,11,15-17H,1-5,9H2.
What are the key properties of 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone?
2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone has a molecular weight of 249.31 g/mol, XLogP of 2.20, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-1-(3,4-dihydroxyphenyl)ethanone is sourced from PubChem (CID 27716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).